Compound Details

 Compound-ID 1273
 Common Name AMP
 Synonyms 5'-AMP
5'-Adenosine monophosphate
5'-Adenylic acid
Adenosine 5'-monophosphate
Adenosine 5'-phosphate
Adenylate
Adenylic acid
 InChI InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1
 SMILES Nc3ncnc1c3(ncn1C2OC(COP(O)(O)=O)C(O)C2(O))
 External Links
 KEGG-COMPOUND-ID C00020
 PUBCHEM-ID 3322
 ChEBI-ID 16027
 REACTOME-ID 159448
 METACYC-ID AMP
 METANETX-ID MNXM14
 BioModels 16027


View all entries for compound AMP




© HITS gGmbH