Compound Details

 Compound-ID 8091
 Common Name Reduced 2,6-dichlorophenolindophenol
 Synonyms 2,6-Dichloro-4-[(4-hydroxyphenyl)amino]phenol
 InChI InChI=1S/C12H9Cl2NO2/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7/h1-6,15-17H
 External Links
 KEGG-COMPOUND-ID C05720
 PUBCHEM-ID 8025
 METACYC-ID CPD-13079
 METANETX-ID MNXM3706


View all entries for compound Reduced 2,6-dichlorophenolindophenol




© HITS gGmbH